2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid

C10H5F3N2O2S — CID 79023733

IUPAC2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(Nc2ccc(F)c(F)c2F)n1
InChIInChI=1S/C10H5F3N2O2S/c11-4-1-2-5(8(13)7(4)12)14-10-15-6(3-18-10)9(16)17/h1-3H,(H,14,15)(H,16,17)
InChIKeyUTOIMHLWMKPARX-UHFFFAOYSA-N
MW274.22 g/mol
LogP3.00
Rot. Bonds3

About 2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid

2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid (PubChem CID 79023733) has the molecular formula C10H5F3N2O2S and a molecular weight of 274.22 g/mol. Its IUPAC name is 2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid
PubChem CID79023733
Molecular FormulaC10H5F3N2O2S
Molecular Weight274.22 g/mol
Exact Mass274.00
IUPAC Name2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(Nc2ccc(F)c(F)c2F)n1
InChIInChI=1S/C10H5F3N2O2S/c11-4-1-2-5(8(13)7(4)12)14-10-15-6(3-18-10)9(16)17/h1-3H,(H,14,15)(H,16,17)
InChIKeyUTOIMHLWMKPARX-UHFFFAOYSA-N
XLogP3.00
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.22
LogP ≤ 53.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid (CID 79023733) is 2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(Nc2ccc(F)c(F)c2F)n1.
What is the InChIKey of 2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid?
The InChIKey is UTOIMHLWMKPARX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F3N2O2S/c11-4-1-2-5(8(13)7(4)12)14-10-15-6(3-18-10)9(16)17/h1-3H,(H,14,15)(H,16,17).
What are the key properties of 2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid?
2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid has a molecular weight of 274.22 g/mol, XLogP of 3.00, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,4-trifluoroanilino)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 79023733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).