C11H9FN2O2S — CID 115423247
methyl 2-(2-fluoroanilino)-1,3-thiazole-4-carboxylate (PubChem CID 115423247) has the molecular formula C11H9FN2O2S and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 2-(2-fluoroanilino)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(2-fluoroanilino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 115423247 |
| Molecular Formula | C11H9FN2O2S |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | methyl 2-(2-fluoroanilino)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(Nc2ccccc2F)n1 |
| InChI | InChI=1S/C11H9FN2O2S/c1-16-10(15)9-6-17-11(14-9)13-8-5-3-2-4-7(8)12/h2-6H,1H3,(H,13,14) |
| InChIKey | KKDBQRZSMQUKDU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |