C12H12N2O3S — CID 80568289
2-[2-(methoxymethyl)anilino]-1,3-thiazole-4-carboxylic acid (PubChem CID 80568289) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-[2-(methoxymethyl)anilino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-(methoxymethyl)anilino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 80568289 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-[2-(methoxymethyl)anilino]-1,3-thiazole-4-carboxylic acid |
| SMILES | COCc1ccccc1Nc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C12H12N2O3S/c1-17-6-8-4-2-3-5-9(8)13-12-14-10(7-18-12)11(15)16/h2-5,7H,6H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | DMCLVFLHRRRWDS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |