C12H11FN2O2S — CID 112724634
methyl 2-[2-(2-fluoroanilino)-1,3-thiazol-4-yl]acetate (PubChem CID 112724634) has the molecular formula C12H11FN2O2S and a molecular weight of 266.30 g/mol. Its IUPAC name is methyl 2-[2-(2-fluoroanilino)-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(2-fluoroanilino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 112724634 |
| Molecular Formula | C12H11FN2O2S |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | methyl 2-[2-(2-fluoroanilino)-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(Nc2ccccc2F)n1 |
| InChI | InChI=1S/C12H11FN2O2S/c1-17-11(16)6-8-7-18-12(14-8)15-10-5-3-2-4-9(10)13/h2-5,7H,6H2,1H3,(H,14,15) |
| InChIKey | IWIXYROTRKLEAP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |