C12H10BrFN2O2S — CID 80574470
methyl 2-[2-(5-bromo-2-fluoroanilino)-1,3-thiazol-4-yl]acetate (PubChem CID 80574470) has the molecular formula C12H10BrFN2O2S and a molecular weight of 345.19 g/mol. Its IUPAC name is methyl 2-[2-(5-bromo-2-fluoroanilino)-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(5-bromo-2-fluoroanilino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 80574470 |
| Molecular Formula | C12H10BrFN2O2S |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | methyl 2-[2-(5-bromo-2-fluoroanilino)-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(Nc2cc(Br)ccc2F)n1 |
| InChI | InChI=1S/C12H10BrFN2O2S/c1-18-11(17)5-8-6-19-12(15-8)16-10-4-7(13)2-3-9(10)14/h2-4,6H,5H2,1H3,(H,15,16) |
| InChIKey | JTMMSWASWHDSOW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |