C12H11BrN2O4S2 — CID 43624485
methyl 2-[2-[(3-bromophenyl)sulfonylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 43624485) has the molecular formula C12H11BrN2O4S2 and a molecular weight of 391.27 g/mol. Its IUPAC name is methyl 2-[2-[(3-bromophenyl)sulfonylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[(3-bromophenyl)sulfonylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 43624485 |
| Molecular Formula | C12H11BrN2O4S2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | methyl 2-[2-[(3-bromophenyl)sulfonylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NS(=O)(=O)c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C12H11BrN2O4S2/c1-19-11(16)6-9-7-20-12(14-9)15-21(17,18)10-4-2-3-8(13)5-10/h2-5,7H,6H2,1H3,(H,14,15) |
| InChIKey | ZNQVDTUTJDHSEN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |