C12H12BrN3O3S2 — CID 4816800
N'-(3-bromophenyl)sulfonyl-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide (PubChem CID 4816800) has the molecular formula C12H12BrN3O3S2 and a molecular weight of 390.28 g/mol. Its IUPAC name is N'-(3-bromophenyl)sulfonyl-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide.
| Compound Name | N'-(3-bromophenyl)sulfonyl-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 4816800 |
| Molecular Formula | C12H12BrN3O3S2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 388.95 |
| IUPAC Name | N'-(3-bromophenyl)sulfonyl-2-(2-methyl-1,3-thiazol-4-yl)acetohydrazide |
| SMILES | Cc1nc(CC(=O)NNS(=O)(=O)c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C12H12BrN3O3S2/c1-8-14-10(7-20-8)6-12(17)15-16-21(18,19)11-4-2-3-9(13)5-11/h2-5,7,16H,6H2,1H3,(H,15,17) |
| InChIKey | PHRWHZKADSNMPE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|