C16H20N4O6S3 — CID 4669667
2-(2-methyl-1,3-thiazol-4-yl)-N'-(4-morpholin-4-ylsulfonylphenyl)sulfonylacetohydrazide (PubChem CID 4669667) has the molecular formula C16H20N4O6S3 and a molecular weight of 460.56 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-N'-(4-morpholin-4-ylsulfonylphenyl)sulfonylacetohydrazide.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-N'-(4-morpholin-4-ylsulfonylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 4669667 |
| Molecular Formula | C16H20N4O6S3 |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-N'-(4-morpholin-4-ylsulfonylphenyl)sulfonylacetohydrazide |
| SMILES | Cc1nc(CC(=O)NNS(=O)(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)cs1 |
| InChI | InChI=1S/C16H20N4O6S3/c1-12-17-13(11-27-12)10-16(21)18-19-28(22,23)14-2-4-15(5-3-14)29(24,25)20-6-8-26-9-7-20/h2-5,11,19H,6-10H2,1H3,(H,18,21) |
| InChIKey | NKWAPRZPWOIAKD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|