C14H14N4O4S2 — CID 7667480
2-(2-methyl-1,3-thiazol-4-yl)-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]acetohydrazide (PubChem CID 7667480) has the molecular formula C14H14N4O4S2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-4-yl)-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]acetohydrazide.
| Compound Name | 2-(2-methyl-1,3-thiazol-4-yl)-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]acetohydrazide |
|---|---|
| PubChem CID | 7667480 |
| Molecular Formula | C14H14N4O4S2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-4-yl)-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]acetohydrazide |
| SMILES | Cc1nc(CC(=O)NNS(=O)(=O)c2ccc3c(c2)CC(=O)N3)cs1 |
| InChI | InChI=1S/C14H14N4O4S2/c1-8-15-10(7-23-8)6-14(20)17-18-24(21,22)11-2-3-12-9(4-11)5-13(19)16-12/h2-4,7,18H,5-6H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | LYYVPOYCVWCSSB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|