C16H15N3O5S — CID 9056007
4-methoxy-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide (PubChem CID 9056007) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is 4-methoxy-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide.
| Compound Name | 4-methoxy-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide |
|---|---|
| PubChem CID | 9056007 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-methoxy-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNS(=O)(=O)c2ccc3c(c2)CC(=O)N3)cc1 |
| InChI | InChI=1S/C16H15N3O5S/c1-24-12-4-2-10(3-5-12)16(21)18-19-25(22,23)13-6-7-14-11(8-13)9-15(20)17-14/h2-8,19H,9H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | DKFWHMRWQPOPPO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|