C21H25N3O5S — CID 18197725
4-hexoxy-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide (PubChem CID 18197725) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is 4-hexoxy-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide.
| Compound Name | 4-hexoxy-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide |
|---|---|
| PubChem CID | 18197725 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-hexoxy-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNS(=O)(=O)c2ccc3c(c2)CC(=O)N3)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-2-3-4-5-12-29-17-8-6-15(7-9-17)21(26)23-24-30(27,28)18-10-11-19-16(13-18)14-20(25)22-19/h6-11,13,24H,2-5,12,14H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | UETHEJWABGVBOB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|