C16H23NO2 — CID 143867556
5-octoxy-1,3-dihydroindol-2-one (PubChem CID 143867556) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 5-octoxy-1,3-dihydroindol-2-one.
| Compound Name | 5-octoxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 143867556 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 5-octoxy-1,3-dihydroindol-2-one |
| SMILES | CCCCCCCCOc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C16H23NO2/c1-2-3-4-5-6-7-10-19-14-8-9-15-13(11-14)12-16(18)17-15/h8-9,11H,2-7,10,12H2,1H3,(H,17,18) |
| InChIKey | GNBBCOADVSNFQG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|