C16H23NO2S — CID 45257676
7-octoxy-4H-1,4-benzothiazin-3-one (PubChem CID 45257676) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 7-octoxy-4H-1,4-benzothiazin-3-one.
| Compound Name | 7-octoxy-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 45257676 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 7-octoxy-4H-1,4-benzothiazin-3-one |
| SMILES | CCCCCCCCOc1ccc2c(c1)SCC(=O)N2 |
| InChI | InChI=1S/C16H23NO2S/c1-2-3-4-5-6-7-10-19-13-8-9-14-15(11-13)20-12-16(18)17-14/h8-9,11H,2-7,10,12H2,1H3,(H,17,18) |
| InChIKey | VGLTTYJKTGYANC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|