C27H35N5O3S — CID 53389551
7-[3-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methyl]piperazin-1-yl]propoxy]-4H-1,4-benzothiazin-3-one (PubChem CID 53389551) has the molecular formula C27H35N5O3S and a molecular weight of 509.68 g/mol. Its IUPAC name is 7-[3-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methyl]piperazin-1-yl]propoxy]-4H-1,4-benzothiazin-3-one.
| Compound Name | 7-[3-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methyl]piperazin-1-yl]propoxy]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 53389551 |
| Molecular Formula | C27H35N5O3S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 7-[3-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methyl]piperazin-1-yl]propoxy]-4H-1,4-benzothiazin-3-one |
| SMILES | CCOCCn1c(CN2CCN(CCCOc3ccc4c(c3)SCC(=O)N4)CC2)nc2ccccc21 |
| InChI | InChI=1S/C27H35N5O3S/c1-2-34-17-15-32-24-7-4-3-6-22(24)28-26(32)19-31-13-11-30(12-14-31)10-5-16-35-21-8-9-23-25(18-21)36-20-27(33)29-23/h3-4,6-9,18H,2,5,10-17,19-20H2,1H3,(H,29,33) |
| InChIKey | FUOOAIBQEJVCBG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|