C29H37N7O10 — CID 19911476
3-[3-[4-[[3-(2-ethoxyethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazin-1-yl]propyl]-1H-benzimidazol-2-one;oxalic acid (PubChem CID 19911476) has the molecular formula C29H37N7O10 and a molecular weight of 643.65 g/mol. Its IUPAC name is 3-[3-[4-[[3-(2-ethoxyethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazin-1-yl]propyl]-1H-benzimidazol-2-one;oxalic acid.
| Compound Name | 3-[3-[4-[[3-(2-ethoxyethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazin-1-yl]propyl]-1H-benzimidazol-2-one;oxalic acid |
|---|---|
| PubChem CID | 19911476 |
| Molecular Formula | C29H37N7O10 |
| Molecular Weight | 643.65 g/mol |
| Exact Mass | 643.26 |
| IUPAC Name | 3-[3-[4-[[3-(2-ethoxyethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazin-1-yl]propyl]-1H-benzimidazol-2-one;oxalic acid |
| SMILES | CCOCCn1c(CN2CCN(CCCn3c(=O)[nH]c4ccccc43)CC2)nc2cccnc21.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H33N7O2.2C2H2O4/c1-2-34-18-17-32-23(27-21-8-5-10-26-24(21)32)19-30-15-13-29(14-16-30)11-6-12-31-22-9-4-3-7-20(22)28-25(31)33;2*3-1(4)2(5)6/h3-5,7-10H,2,6,11-19H2,1H3,(H,28,33);2*(H,3,4)(H,5,6) |
| InChIKey | FANHPUKATZPODI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 233.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.65 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|