C18H28N4O — CID 14855700
3-(2-ethoxyethyl)-2-(3-piperidin-1-ylpropyl)imidazo[4,5-b]pyridine (PubChem CID 14855700) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-2-(3-piperidin-1-ylpropyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(2-ethoxyethyl)-2-(3-piperidin-1-ylpropyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 14855700 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 3-(2-ethoxyethyl)-2-(3-piperidin-1-ylpropyl)imidazo[4,5-b]pyridine |
| SMILES | CCOCCn1c(CCCN2CCCCC2)nc2cccnc21 |
| InChI | InChI=1S/C18H28N4O/c1-2-23-15-14-22-17(20-16-8-6-10-19-18(16)22)9-7-13-21-11-4-3-5-12-21/h6,8,10H,2-5,7,9,11-15H2,1H3 |
| InChIKey | PHYYRJYLDBHAGG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|