C27H39N5O9 — CID 67896497
bis(but-2-enedioic acid);3-(2-ethoxyethyl)-2-[4-(4-methylpiperazin-1-yl)butyl]imidazo[4,5-b]pyridine (PubChem CID 67896497) has the molecular formula C27H39N5O9 and a molecular weight of 577.64 g/mol. Its IUPAC name is bis(but-2-enedioic acid);3-(2-ethoxyethyl)-2-[4-(4-methylpiperazin-1-yl)butyl]imidazo[4,5-b]pyridine.
| Compound Name | bis(but-2-enedioic acid);3-(2-ethoxyethyl)-2-[4-(4-methylpiperazin-1-yl)butyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 67896497 |
| Molecular Formula | C27H39N5O9 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | bis(but-2-enedioic acid);3-(2-ethoxyethyl)-2-[4-(4-methylpiperazin-1-yl)butyl]imidazo[4,5-b]pyridine |
| SMILES | CCOCCn1c(CCCCN2CCN(C)CC2)nc2cccnc21.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H31N5O.2C4H4O4/c1-3-25-16-15-24-18(21-17-7-6-9-20-19(17)24)8-4-5-10-23-13-11-22(2)12-14-23;2*5-3(6)1-2-4(7)8/h6-7,9H,3-5,8,10-16H2,1-2H3;2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | DDMZKMLXPFFDLQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 195.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|