C24H32N4O9 — CID 67923199
bis((E)-but-2-enedioic acid);3-(2-ethoxyethyl)-2-[(3R)-1-methylpiperidin-3-yl]imidazo[4,5-b]pyridine (PubChem CID 67923199) has the molecular formula C24H32N4O9 and a molecular weight of 520.54 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);3-(2-ethoxyethyl)-2-[(3R)-1-methylpiperidin-3-yl]imidazo[4,5-b]pyridine.
| Compound Name | bis((E)-but-2-enedioic acid);3-(2-ethoxyethyl)-2-[(3R)-1-methylpiperidin-3-yl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 67923199 |
| Molecular Formula | C24H32N4O9 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | bis((E)-but-2-enedioic acid);3-(2-ethoxyethyl)-2-[(3R)-1-methylpiperidin-3-yl]imidazo[4,5-b]pyridine |
| SMILES | CCOCCn1c([C@@H]2CCCN(C)C2)nc2cccnc21.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H24N4O.2C4H4O4/c1-3-21-11-10-20-15(13-6-5-9-19(2)12-13)18-14-7-4-8-17-16(14)20;2*5-3(6)1-2-4(7)8/h4,7-8,13H,3,5-6,9-12H2,1-2H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+/t13-;;/m1../s1 |
| InChIKey | RCMMGSWKBXAIQM-VISMVFRMSA-N |
| XLogP | 1.70 |
| TPSA | 192.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|