C15H21N3O2 — CID 20955384
4-[3-(3-methylbutyl)imidazo[4,5-b]pyridin-2-yl]butanoic acid (PubChem CID 20955384) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-[3-(3-methylbutyl)imidazo[4,5-b]pyridin-2-yl]butanoic acid.
| Compound Name | 4-[3-(3-methylbutyl)imidazo[4,5-b]pyridin-2-yl]butanoic acid |
|---|---|
| PubChem CID | 20955384 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-[3-(3-methylbutyl)imidazo[4,5-b]pyridin-2-yl]butanoic acid |
| SMILES | CC(C)CCn1c(CCCC(=O)O)nc2cccnc21 |
| InChI | InChI=1S/C15H21N3O2/c1-11(2)8-10-18-13(6-3-7-14(19)20)17-12-5-4-9-16-15(12)18/h4-5,9,11H,3,6-8,10H2,1-2H3,(H,19,20) |
| InChIKey | XEZWBVBRQWZIOL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |