C11H16N4 — CID 79289500
3-(3-methylbutyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 79289500) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 3-(3-methylbutyl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(3-methylbutyl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 79289500 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3-(3-methylbutyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | CC(C)CCn1c(N)nc2cccnc21 |
| InChI | InChI=1S/C11H16N4/c1-8(2)5-7-15-10-9(14-11(15)12)4-3-6-13-10/h3-4,6,8H,5,7H2,1-2H3,(H2,12,14) |
| InChIKey | VKAMEODINDRJSH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |