C11H16N4 — CID 79290142
3-pentan-3-ylimidazo[4,5-b]pyridin-2-amine (PubChem CID 79290142) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 3-pentan-3-ylimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-pentan-3-ylimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 79290142 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3-pentan-3-ylimidazo[4,5-b]pyridin-2-amine |
| SMILES | CCC(CC)n1c(N)nc2cccnc21 |
| InChI | InChI=1S/C11H16N4/c1-3-8(4-2)15-10-9(14-11(15)12)6-5-7-13-10/h5-8H,3-4H2,1-2H3,(H2,12,14) |
| InChIKey | FRHMCAUNOLLPAI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |