C13H16N6 — CID 79289839
3-(4-imidazol-1-ylbutyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 79289839) has the molecular formula C13H16N6 and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-(4-imidazol-1-ylbutyl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(4-imidazol-1-ylbutyl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 79289839 |
| Molecular Formula | C13H16N6 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-(4-imidazol-1-ylbutyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | Nc1nc2cccnc2n1CCCCn1ccnc1 |
| InChI | InChI=1S/C13H16N6/c14-13-17-11-4-3-5-16-12(11)19(13)8-2-1-7-18-9-6-15-10-18/h3-6,9-10H,1-2,7-8H2,(H2,14,17) |
| InChIKey | KVIQFLHPIRLREA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|