C12H18N4O — CID 79289761
3-(2-butoxyethyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 79289761) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-(2-butoxyethyl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(2-butoxyethyl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 79289761 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 3-(2-butoxyethyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | CCCCOCCn1c(N)nc2cccnc21 |
| InChI | InChI=1S/C12H18N4O/c1-2-3-8-17-9-7-16-11-10(15-12(16)13)5-4-6-14-11/h4-6H,2-3,7-9H2,1H3,(H2,13,15) |
| InChIKey | ANVVHTMDOIBJNY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|