C12H18N4O — CID 112739245
2-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethoxy]ethanamine (PubChem CID 112739245) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethoxy]ethanamine.
| Compound Name | 2-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 112739245 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-[2-(3-ethylimidazo[4,5-b]pyridin-2-yl)ethoxy]ethanamine |
| SMILES | CCn1c(CCOCCN)nc2cccnc21 |
| InChI | InChI=1S/C12H18N4O/c1-2-16-11(5-8-17-9-6-13)15-10-4-3-7-14-12(10)16/h3-4,7H,2,5-6,8-9,13H2,1H3 |
| InChIKey | XGUPXFZEOPDDFL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|