C9H11N3 — CID 23298284
3-ethyl-2-methylimidazo[4,5-b]pyridine (PubChem CID 23298284) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 3-ethyl-2-methylimidazo[4,5-b]pyridine.
| Compound Name | 3-ethyl-2-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 23298284 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 3-ethyl-2-methylimidazo[4,5-b]pyridine |
| SMILES | CCn1c(C)nc2cccnc21 |
| InChI | InChI=1S/C9H11N3/c1-3-12-7(2)11-8-5-4-6-10-9(8)12/h4-6H,3H2,1-2H3 |
| InChIKey | VIYYWKAZGZMPRT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |