C15H16N4 — CID 63758337
5-(3-ethylimidazo[4,5-b]pyridin-2-yl)-2-methylaniline (PubChem CID 63758337) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is 5-(3-ethylimidazo[4,5-b]pyridin-2-yl)-2-methylaniline.
| Compound Name | 5-(3-ethylimidazo[4,5-b]pyridin-2-yl)-2-methylaniline |
|---|---|
| PubChem CID | 63758337 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 5-(3-ethylimidazo[4,5-b]pyridin-2-yl)-2-methylaniline |
| SMILES | CCn1c(-c2ccc(C)c(N)c2)nc2cccnc21 |
| InChI | InChI=1S/C15H16N4/c1-3-19-14(11-7-6-10(2)12(16)9-11)18-13-5-4-8-17-15(13)19/h4-9H,3,16H2,1-2H3 |
| InChIKey | KCPVQKQYGYXHSZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|