C14H12N4 — CID 141174884
2-methyl-5-pyrido[2,3-b]pyrazin-3-ylaniline (PubChem CID 141174884) has the molecular formula C14H12N4 and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-methyl-5-pyrido[2,3-b]pyrazin-3-ylaniline.
| Compound Name | 2-methyl-5-pyrido[2,3-b]pyrazin-3-ylaniline |
|---|---|
| PubChem CID | 141174884 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-methyl-5-pyrido[2,3-b]pyrazin-3-ylaniline |
| SMILES | Cc1ccc(-c2cnc3cccnc3n2)cc1N |
| InChI | InChI=1S/C14H12N4/c1-9-4-5-10(7-11(9)15)13-8-17-12-3-2-6-16-14(12)18-13/h2-8H,15H2,1H3 |
| InChIKey | KCLZHILGLLTQFN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|