C17H14N6 — CID 141348313
3-[(4-pyrido[2,3-b]pyrazin-3-ylpyrazol-1-yl)methyl]aniline (PubChem CID 141348313) has the molecular formula C17H14N6 and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-[(4-pyrido[2,3-b]pyrazin-3-ylpyrazol-1-yl)methyl]aniline.
| Compound Name | 3-[(4-pyrido[2,3-b]pyrazin-3-ylpyrazol-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 141348313 |
| Molecular Formula | C17H14N6 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-[(4-pyrido[2,3-b]pyrazin-3-ylpyrazol-1-yl)methyl]aniline |
| SMILES | Nc1cccc(Cn2cc(-c3cnc4cccnc4n3)cn2)c1 |
| InChI | InChI=1S/C17H14N6/c18-14-4-1-3-12(7-14)10-23-11-13(8-21-23)16-9-20-15-5-2-6-19-17(15)22-16/h1-9,11H,10,18H2 |
| InChIKey | LBUIYTPMSBBMSH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|