C21H18F3N7S — CID 66556266
1-[3-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 66556266) has the molecular formula C21H18F3N7S and a molecular weight of 457.49 g/mol. Its IUPAC name is 1-[3-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-[3-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 66556266 |
| Molecular Formula | C21H18F3N7S |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 1-[3-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | Cc1cccc(Cn2cc(-c3cnc4ccc(NC(=S)NCC(F)(F)F)nc4n3)cn2)c1 |
| InChI | InChI=1S/C21H18F3N7S/c1-13-3-2-4-14(7-13)10-31-11-15(8-27-31)17-9-25-16-5-6-18(29-19(16)28-17)30-20(32)26-12-21(22,23)24/h2-9,11H,10,12H2,1H3,(H2,26,28,29,30,32) |
| InChIKey | FFQFPHPQKMMBSG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|