C23H23N7O2S — CID 88994009
1-[3-[1-[(3,4-dimethoxyphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea (PubChem CID 88994009) has the molecular formula C23H23N7O2S and a molecular weight of 461.55 g/mol. Its IUPAC name is 1-[3-[1-[(3,4-dimethoxyphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[3-[1-[(3,4-dimethoxyphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 88994009 |
| Molecular Formula | C23H23N7O2S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 1-[3-[1-[(3,4-dimethoxyphenyl)methyl]pyrazol-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc2ncc(-c3cnn(Cc4ccc(OC)c(OC)c4)c3)nc2n1 |
| InChI | InChI=1S/C23H23N7O2S/c1-4-9-24-23(33)29-21-8-6-17-22(28-21)27-18(12-25-17)16-11-26-30(14-16)13-15-5-7-19(31-2)20(10-15)32-3/h4-8,10-12,14H,1,9,13H2,2-3H3,(H2,24,27,28,29,33) |
| InChIKey | MIBJRBFMUSTTOH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|