C21H20N8OS — CID 163437076
N-[4-[[4-[6-(ethylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]pyrazol-1-yl]methyl]phenyl]methanimine oxide (PubChem CID 163437076) has the molecular formula C21H20N8OS and a molecular weight of 432.51 g/mol. Its IUPAC name is N-[4-[[4-[6-(ethylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]pyrazol-1-yl]methyl]phenyl]methanimine oxide.
| Compound Name | N-[4-[[4-[6-(ethylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]pyrazol-1-yl]methyl]phenyl]methanimine oxide |
|---|---|
| PubChem CID | 163437076 |
| Molecular Formula | C21H20N8OS |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[4-[[4-[6-(ethylcarbamothioylamino)pyrido[2,3-b]pyrazin-3-yl]pyrazol-1-yl]methyl]phenyl]methanimine oxide |
| SMILES | C=[N+]([O-])c1ccc(Cn2cc(-c3cnc4ccc(NC(=S)NCC)nc4n3)cn2)cc1 |
| InChI | InChI=1S/C21H20N8OS/c1-3-22-21(31)27-19-9-8-17-20(26-19)25-18(11-23-17)15-10-24-29(13-15)12-14-4-6-16(7-5-14)28(2)30/h4-11,13H,2-3,12H2,1H3,(H2,22,25,26,27,31) |
| InChIKey | AVKNPSKLBPQAQA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|