C17H15N5OS — CID 11233010
1-[3-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea (PubChem CID 11233010) has the molecular formula C17H15N5OS and a molecular weight of 337.41 g/mol. Its IUPAC name is 1-[3-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[3-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 11233010 |
| Molecular Formula | C17H15N5OS |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-[3-(3-hydroxyphenyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc2ncc(-c3cccc(O)c3)nc2n1 |
| InChI | InChI=1S/C17H15N5OS/c1-2-8-18-17(24)22-15-7-6-13-16(21-15)20-14(10-19-13)11-4-3-5-12(23)9-11/h2-7,9-10,23H,1,8H2,(H2,18,20,21,22,24) |
| InChIKey | KQZVKLDSKAWHJQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|