C12H10N6O2 — CID 135750190
4-(2,4-diaminopteridin-6-yl)benzene-1,2-diol (PubChem CID 135750190) has the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 4-(2,4-diaminopteridin-6-yl)benzene-1,2-diol.
| Compound Name | 4-(2,4-diaminopteridin-6-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 135750190 |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-(2,4-diaminopteridin-6-yl)benzene-1,2-diol |
| SMILES | Nc1nc(N)c2nc(-c3ccc(O)c(O)c3)cnc2n1 |
| InChI | InChI=1S/C12H10N6O2/c13-10-9-11(18-12(14)17-10)15-4-6(16-9)5-1-2-7(19)8(20)3-5/h1-4,19-20H,(H4,13,14,15,17,18) |
| InChIKey | RENIFQAUBSYIID-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|