About 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol
3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol (PubChem CID 10427712) has the molecular formula C18H14N6O2
and a molecular weight of 346.35 g/mol. Its IUPAC name is 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol.
Molecular Properties
| Compound Name | 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol |
| PubChem CID | 10427712 |
| Molecular Formula | C18H14N6O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol |
| SMILES | Nc1nc(N)c2nc(-c3cccc(O)c3)c(-c3cccc(O)c3)nc2n1 |
| InChI | InChI=1S/C18H14N6O2/c19-16-15-17(24-18(20)23-16)22-14(10-4-2-6-12(26)8-10)13(21-15)9-3-1-5-11(25)7-9/h1-8,25-26H,(H4,19,20,22,23,24) |
| InChIKey | UJIAQDJKSXQLIT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol?
The IUPAC name of 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol (CID 10427712) is 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol.
What is the SMILES notation for 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol?
The canonical SMILES for 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol is Nc1nc(N)c2nc(-c3cccc(O)c3)c(-c3cccc(O)c3)nc2n1.
What is the InChIKey of 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol?
The InChIKey is UJIAQDJKSXQLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N6O2/c19-16-15-17(24-18(20)23-16)22-14(10-4-2-6-12(26)8-10)13(21-15)9-3-1-5-11(25)7-9/h1-8,25-26H,(H4,19,20,22,23,24).
What are the key properties of 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol?
3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol has a molecular weight of 346.35 g/mol, XLogP of 2.33, 2 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol is sourced from PubChem (CID 10427712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).