C18H14N6O2 — CID 10427712
3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol (PubChem CID 10427712) has the molecular formula C18H14N6O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol.
| Compound Name | 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol |
|---|---|
| PubChem CID | 10427712 |
| Molecular Formula | C18H14N6O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol |
| SMILES | Nc1nc(N)c2nc(-c3cccc(O)c3)c(-c3cccc(O)c3)nc2n1 |
| InChI | InChI=1S/C18H14N6O2/c19-16-15-17(24-18(20)23-16)22-14(10-4-2-6-12(26)8-10)13(21-15)9-3-1-5-11(25)7-9/h1-8,25-26H,(H4,19,20,22,23,24) |
| InChIKey | UJIAQDJKSXQLIT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |