C18H14N6O4 — CID 135485500
4-[2,4-diamino-7-(3,4-dihydroxyphenyl)pteridin-6-yl]benzene-1,2-diol (PubChem CID 135485500) has the molecular formula C18H14N6O4 and a molecular weight of 378.35 g/mol. Its IUPAC name is 4-[2,4-diamino-7-(3,4-dihydroxyphenyl)pteridin-6-yl]benzene-1,2-diol.
| Compound Name | 4-[2,4-diamino-7-(3,4-dihydroxyphenyl)pteridin-6-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135485500 |
| Molecular Formula | C18H14N6O4 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 4-[2,4-diamino-7-(3,4-dihydroxyphenyl)pteridin-6-yl]benzene-1,2-diol |
| SMILES | Nc1nc(N)c2nc(-c3ccc(O)c(O)c3)c(-c3ccc(O)c(O)c3)nc2n1 |
| InChI | InChI=1S/C18H14N6O4/c19-16-15-17(24-18(20)23-16)22-14(8-2-4-10(26)12(28)6-8)13(21-15)7-1-3-9(25)11(27)5-7/h1-6,25-28H,(H4,19,20,22,23,24) |
| InChIKey | UALXDORCKXAHJH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 184.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|