C12H9N5O2 — CID 135610087
4-(4-aminopteridin-7-yl)benzene-1,2-diol (PubChem CID 135610087) has the molecular formula C12H9N5O2 and a molecular weight of 255.24 g/mol. Its IUPAC name is 4-(4-aminopteridin-7-yl)benzene-1,2-diol.
| Compound Name | 4-(4-aminopteridin-7-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 135610087 |
| Molecular Formula | C12H9N5O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-(4-aminopteridin-7-yl)benzene-1,2-diol |
| SMILES | Nc1ncnc2nc(-c3ccc(O)c(O)c3)cnc12 |
| InChI | InChI=1S/C12H9N5O2/c13-11-10-12(16-5-15-11)17-7(4-14-10)6-1-2-8(18)9(19)3-6/h1-5,18-19H,(H2,13,15,16,17) |
| InChIKey | XBUHCGAFDXGUFA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|