C22H23N7O2S — CID 66556769
1-[3-(1-benzylpyrazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]-3-(2,2-dimethoxyethyl)thiourea (PubChem CID 66556769) has the molecular formula C22H23N7O2S and a molecular weight of 449.54 g/mol. Its IUPAC name is 1-[3-(1-benzylpyrazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]-3-(2,2-dimethoxyethyl)thiourea.
| Compound Name | 1-[3-(1-benzylpyrazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]-3-(2,2-dimethoxyethyl)thiourea |
|---|---|
| PubChem CID | 66556769 |
| Molecular Formula | C22H23N7O2S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 1-[3-(1-benzylpyrazol-4-yl)pyrido[2,3-b]pyrazin-6-yl]-3-(2,2-dimethoxyethyl)thiourea |
| SMILES | COC(CNC(=S)Nc1ccc2ncc(-c3cnn(Cc4ccccc4)c3)nc2n1)OC |
| InChI | InChI=1S/C22H23N7O2S/c1-30-20(31-2)12-24-22(32)28-19-9-8-17-21(27-19)26-18(11-23-17)16-10-25-29(14-16)13-15-6-4-3-5-7-15/h3-11,14,20H,12-13H2,1-2H3,(H2,24,26,27,28,32) |
| InChIKey | BXUIHXWRWDXGMX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|