C11H16N2O2S — CID 1474302
1-(2,2-dimethoxyethyl)-3-phenylthiourea (PubChem CID 1474302) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-3-phenylthiourea.
| Compound Name | 1-(2,2-dimethoxyethyl)-3-phenylthiourea |
|---|---|
| PubChem CID | 1474302 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-3-phenylthiourea |
| SMILES | COC(CNC(=S)Nc1ccccc1)OC |
| InChI | InChI=1S/C11H16N2O2S/c1-14-10(15-2)8-12-11(16)13-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H2,12,13,16) |
| InChIKey | CZSGUUDZDGJLFK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|