C25H28N2S — CID 3281911
1-(4-tert-butylphenyl)-3-(2,2-diphenylethyl)thiourea (PubChem CID 3281911) has the molecular formula C25H28N2S and a molecular weight of 388.58 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(2,2-diphenylethyl)thiourea.
| Compound Name | 1-(4-tert-butylphenyl)-3-(2,2-diphenylethyl)thiourea |
|---|---|
| PubChem CID | 3281911 |
| Molecular Formula | C25H28N2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(2,2-diphenylethyl)thiourea |
| SMILES | CC(C)(C)c1ccc(NC(=S)NCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N2S/c1-25(2,3)21-14-16-22(17-15-21)27-24(28)26-18-23(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-17,23H,18H2,1-3H3,(H2,26,27,28) |
| InChIKey | XVBHTZHKZALXHX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|