C24H25NO — CID 7914210
N-(4-tert-butylphenyl)-2,2-diphenylacetamide (PubChem CID 7914210) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2,2-diphenylacetamide.
| Compound Name | N-(4-tert-butylphenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 7914210 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-2,2-diphenylacetamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO/c1-24(2,3)20-14-16-21(17-15-20)25-23(26)22(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-17,22H,1-3H3,(H,25,26) |
| InChIKey | FSXABWUWSOGWCB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |