C22H19NO — CID 122527147
N-(4-ethenylphenyl)-2,2-diphenylacetamide (PubChem CID 122527147) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(4-ethenylphenyl)-2,2-diphenylacetamide.
| Compound Name | N-(4-ethenylphenyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 122527147 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-(4-ethenylphenyl)-2,2-diphenylacetamide |
| SMILES | C=Cc1ccc(NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19NO/c1-2-17-13-15-20(16-14-17)23-22(24)21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h2-16,21H,1H2,(H,23,24) |
| InChIKey | RVRMFGMZYFGMHY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |