C27H23N3O2 — CID 18293083
2,2-diphenyl-N-[3-(phenylcarbamoylamino)phenyl]acetamide (PubChem CID 18293083) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2,2-diphenyl-N-[3-(phenylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[3-(phenylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 18293083 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2,2-diphenyl-N-[3-(phenylcarbamoylamino)phenyl]acetamide |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(NC(=O)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H23N3O2/c31-26(25(20-11-4-1-5-12-20)21-13-6-2-7-14-21)28-23-17-10-18-24(19-23)30-27(32)29-22-15-8-3-9-16-22/h1-19,25H,(H,28,31)(H2,29,30,32) |
| InChIKey | TZRVCLFFKRQCDB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |