C29H26N2O2 — CID 43877741
3-[(2,2-diphenylacetyl)amino]-N-(1-phenylethyl)benzamide (PubChem CID 43877741) has the molecular formula C29H26N2O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-[(2,2-diphenylacetyl)amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 3-[(2,2-diphenylacetyl)amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 43877741 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 3-[(2,2-diphenylacetyl)amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(NC(=O)C(c2ccccc2)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C29H26N2O2/c1-21(22-12-5-2-6-13-22)30-28(32)25-18-11-19-26(20-25)31-29(33)27(23-14-7-3-8-15-23)24-16-9-4-10-17-24/h2-21,27H,1H3,(H,30,32)(H,31,33) |
| InChIKey | OYHKDDWLGPGBQI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |