C39H44N4O4 — CID 43878143
N,N'-bis[3-(1-phenylethylcarbamoyl)phenyl]nonanediamide (PubChem CID 43878143) has the molecular formula C39H44N4O4 and a molecular weight of 632.81 g/mol. Its IUPAC name is N,N'-bis[3-(1-phenylethylcarbamoyl)phenyl]nonanediamide.
| Compound Name | N,N'-bis[3-(1-phenylethylcarbamoyl)phenyl]nonanediamide |
|---|---|
| PubChem CID | 43878143 |
| Molecular Formula | C39H44N4O4 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | N,N'-bis[3-(1-phenylethylcarbamoyl)phenyl]nonanediamide |
| SMILES | CC(NC(=O)c1cccc(NC(=O)CCCCCCCC(=O)Nc2cccc(C(=O)NC(C)c3ccccc3)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C39H44N4O4/c1-28(30-16-8-6-9-17-30)40-38(46)32-20-14-22-34(26-32)42-36(44)24-12-4-3-5-13-25-37(45)43-35-23-15-21-33(27-35)39(47)41-29(2)31-18-10-7-11-19-31/h6-11,14-23,26-29H,3-5,12-13,24-25H2,1-2H3,(H,40,46)(H,41,47)(H,42,44)(H,43,45) |
| InChIKey | DAXWZBQTSXXGFV-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|