C22H26N2O5 — CID 43877852
2-methoxyethyl 4-oxo-4-[3-(1-phenylethylcarbamoyl)anilino]butanoate (PubChem CID 43877852) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-methoxyethyl 4-oxo-4-[3-(1-phenylethylcarbamoyl)anilino]butanoate.
| Compound Name | 2-methoxyethyl 4-oxo-4-[3-(1-phenylethylcarbamoyl)anilino]butanoate |
|---|---|
| PubChem CID | 43877852 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-methoxyethyl 4-oxo-4-[3-(1-phenylethylcarbamoyl)anilino]butanoate |
| SMILES | COCCOC(=O)CCC(=O)Nc1cccc(C(=O)NC(C)c2ccccc2)c1 |
| InChI | InChI=1S/C22H26N2O5/c1-16(17-7-4-3-5-8-17)23-22(27)18-9-6-10-19(15-18)24-20(25)11-12-21(26)29-14-13-28-2/h3-10,15-16H,11-14H2,1-2H3,(H,23,27)(H,24,25) |
| InChIKey | ONOFQBPCYRSPDJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|