C23H27N3O4S — CID 17197716
2-phenylethyl 4-oxo-4-[[3-(propan-2-ylcarbamoyl)phenyl]carbamothioylamino]butanoate (PubChem CID 17197716) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 2-phenylethyl 4-oxo-4-[[3-(propan-2-ylcarbamoyl)phenyl]carbamothioylamino]butanoate.
| Compound Name | 2-phenylethyl 4-oxo-4-[[3-(propan-2-ylcarbamoyl)phenyl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 17197716 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-phenylethyl 4-oxo-4-[[3-(propan-2-ylcarbamoyl)phenyl]carbamothioylamino]butanoate |
| SMILES | CC(C)NC(=O)c1cccc(NC(=S)NC(=O)CCC(=O)OCCc2ccccc2)c1 |
| InChI | InChI=1S/C23H27N3O4S/c1-16(2)24-22(29)18-9-6-10-19(15-18)25-23(31)26-20(27)11-12-21(28)30-14-13-17-7-4-3-5-8-17/h3-10,15-16H,11-14H2,1-2H3,(H,24,29)(H2,25,26,27,31) |
| InChIKey | SZKZFPLQWFFHQB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|