C16H21N3O4S — CID 17233246
propyl 4-[[3-(methylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 17233246) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is propyl 4-[[3-(methylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | propyl 4-[[3-(methylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17233246 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | propyl 4-[[3-(methylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCCOC(=O)CCC(=O)NC(=S)Nc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C16H21N3O4S/c1-3-9-23-14(21)8-7-13(20)19-16(24)18-12-6-4-5-11(10-12)15(22)17-2/h4-6,10H,3,7-9H2,1-2H3,(H,17,22)(H2,18,19,20,24) |
| InChIKey | IRGCCIOSYFUDPN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|