C17H23N3O4S — CID 17232100
propyl 4-[[3-(dimethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 17232100) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is propyl 4-[[3-(dimethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | propyl 4-[[3-(dimethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 17232100 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | propyl 4-[[3-(dimethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCCOC(=O)CCC(=O)NC(=S)Nc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C17H23N3O4S/c1-4-10-24-15(22)9-8-14(21)19-17(25)18-13-7-5-6-12(11-13)16(23)20(2)3/h5-7,11H,4,8-10H2,1-3H3,(H2,18,19,21,25) |
| InChIKey | GCFZEBGABCUAES-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|