C16H23N3O2S — CID 17232125
3-(hexanoylcarbamothioylamino)-N,N-dimethylbenzamide (PubChem CID 17232125) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 3-(hexanoylcarbamothioylamino)-N,N-dimethylbenzamide.
| Compound Name | 3-(hexanoylcarbamothioylamino)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 17232125 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-(hexanoylcarbamothioylamino)-N,N-dimethylbenzamide |
| SMILES | CCCCCC(=O)NC(=S)Nc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C16H23N3O2S/c1-4-5-6-10-14(20)18-16(22)17-13-9-7-8-12(11-13)15(21)19(2)3/h7-9,11H,4-6,10H2,1-3H3,(H2,17,18,20,22) |
| InChIKey | QDOWFXZTRFDBJB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|