C18H27N3O2S — CID 17199239
N-butan-2-yl-3-(hexanoylcarbamothioylamino)benzamide (PubChem CID 17199239) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-butan-2-yl-3-(hexanoylcarbamothioylamino)benzamide.
| Compound Name | N-butan-2-yl-3-(hexanoylcarbamothioylamino)benzamide |
|---|---|
| PubChem CID | 17199239 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-butan-2-yl-3-(hexanoylcarbamothioylamino)benzamide |
| SMILES | CCCCCC(=O)NC(=S)Nc1cccc(C(=O)NC(C)CC)c1 |
| InChI | InChI=1S/C18H27N3O2S/c1-4-6-7-11-16(22)21-18(24)20-15-10-8-9-14(12-15)17(23)19-13(3)5-2/h8-10,12-13H,4-7,11H2,1-3H3,(H,19,23)(H2,20,21,22,24) |
| InChIKey | CWVHJABJYLNSEC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|